C19H42NO+ — CID 58743334
[(2S,3R)-3-hydroxynonadecan-2-yl]azanium (PubChem CID 58743334) has the molecular formula C19H42NO+ and a molecular weight of 300.55 g/mol. Its IUPAC name is [(2S,3R)-3-hydroxynonadecan-2-yl]azanium.
| Compound Name | [(2S,3R)-3-hydroxynonadecan-2-yl]azanium |
|---|---|
| PubChem CID | 58743334 |
| Molecular Formula | C19H42NO+ |
| Molecular Weight | 300.55 g/mol |
| Exact Mass | 300.33 |
| IUPAC Name | [(2S,3R)-3-hydroxynonadecan-2-yl]azanium |
| SMILES | CCCCCCCCCCCCCCCC[C@@H](O)[C@H](C)[NH3+] |
| InChI | InChI=1S/C19H41NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(21)18(2)20/h18-19,21H,3-17,20H2,1-2H3/p+1/t18-,19+/m0/s1 |
| InChIKey | UJYQLGQRZHVYGT-RBUKOAKNSA-O |
| XLogP | 4.85 |
| TPSA | 47.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|