C44H50O7 — CID 158404403
methyl (1R,2S,3S,4R,5S)-2-methyl-5-[4-methyl-3-[[4-(4-prop-2-enoxybutyl)phenyl]methyl]phenyl]-3,4-bis(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane-1-carboxylate (PubChem CID 158404403) has the molecular formula C44H50O7 and a molecular weight of 690.88 g/mol. Its IUPAC name is methyl (1R,2S,3S,4R,5S)-2-methyl-5-[4-methyl-3-[[4-(4-prop-2-enoxybutyl)phenyl]methyl]phenyl]-3,4-bis(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane-1-carboxylate.
| Compound Name | methyl (1R,2S,3S,4R,5S)-2-methyl-5-[4-methyl-3-[[4-(4-prop-2-enoxybutyl)phenyl]methyl]phenyl]-3,4-bis(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane-1-carboxylate |
|---|---|
| PubChem CID | 158404403 |
| Molecular Formula | C44H50O7 |
| Molecular Weight | 690.88 g/mol |
| Exact Mass | 690.36 |
| IUPAC Name | methyl (1R,2S,3S,4R,5S)-2-methyl-5-[4-methyl-3-[[4-(4-prop-2-enoxybutyl)phenyl]methyl]phenyl]-3,4-bis(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane-1-carboxylate |
| SMILES | C=CCOCCCCc1ccc(Cc2cc([C@]34OC[C@](C(=O)OC)(O3)[C@@H](C)[C@H](OCc3ccccc3)[C@H]4OCc3ccccc3)ccc2C)cc1 |
| InChI | InChI=1S/C44H50O7/c1-5-25-47-26-13-12-14-34-20-22-35(23-21-34)27-38-28-39(24-19-32(38)2)44-41(49-30-37-17-10-7-11-18-37)40(48-29-36-15-8-6-9-16-36)33(3)43(51-44,31-50-44)42(45)46-4/h5-11,15-24,28,33,40-41H,1,12-14,25-27,29-31H2,2-4H3/t33-,40-,41+,43-,44-/m0/s1 |
| InChIKey | GYMPZMMXAKXJDZ-XCIYTPMISA-N |
| XLogP | 8.04 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.88 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|