C30H50N3P — CID 158409110
N'-tert-butyl-1-dicyclohexylphosphanyl-N-[4-(4,4-dimethylpentan-2-ylideneamino)phenyl]methanimidamide (PubChem CID 158409110) has the molecular formula C30H50N3P and a molecular weight of 483.73 g/mol. Its IUPAC name is N'-tert-butyl-1-dicyclohexylphosphanyl-N-[4-(4,4-dimethylpentan-2-ylideneamino)phenyl]methanimidamide.
| Compound Name | N'-tert-butyl-1-dicyclohexylphosphanyl-N-[4-(4,4-dimethylpentan-2-ylideneamino)phenyl]methanimidamide |
|---|---|
| PubChem CID | 158409110 |
| Molecular Formula | C30H50N3P |
| Molecular Weight | 483.73 g/mol |
| Exact Mass | 483.37 |
| IUPAC Name | N'-tert-butyl-1-dicyclohexylphosphanyl-N-[4-(4,4-dimethylpentan-2-ylideneamino)phenyl]methanimidamide |
| SMILES | C/C(CC(C)(C)C)=N\c1ccc(N/C(=N/C(C)(C)C)P(C2CCCCC2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C30H50N3P/c1-23(22-29(2,3)4)31-24-18-20-25(21-19-24)32-28(33-30(5,6)7)34(26-14-10-8-11-15-26)27-16-12-9-13-17-27/h18-21,26-27H,8-17,22H2,1-7H3,(H,32,33)/b31-23+ |
| InChIKey | BHDXOECPKYONJB-UQRQXUALSA-N |
| XLogP | 9.93 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.73 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|