C20H52N8 — CID 158426827
N,N-dimethylbutan-1-amine;N'-[2-[2-(propylamino)ethylamino]ethyl]ethane-1,2-diamine;1,1,3,3-tetramethylguanidine (PubChem CID 158426827) has the molecular formula C20H52N8 and a molecular weight of 404.69 g/mol. Its IUPAC name is N,N-dimethylbutan-1-amine;N'-[2-[2-(propylamino)ethylamino]ethyl]ethane-1,2-diamine;1,1,3,3-tetramethylguanidine.
| Compound Name | N,N-dimethylbutan-1-amine;N'-[2-[2-(propylamino)ethylamino]ethyl]ethane-1,2-diamine;1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 158426827 |
| Molecular Formula | C20H52N8 |
| Molecular Weight | 404.69 g/mol |
| Exact Mass | 404.43 |
| IUPAC Name | N,N-dimethylbutan-1-amine;N'-[2-[2-(propylamino)ethylamino]ethyl]ethane-1,2-diamine;1,1,3,3-tetramethylguanidine |
| SMILES | CCCCN(C)C.CCCNCCNCCNCCN.[H]N=C(N(C)C)N(C)C |
| InChI | InChI=1S/C9H24N4.C6H15N.C5H13N3/c1-2-4-11-6-8-13-9-7-12-5-3-10;1-4-5-6-7(2)3;1-7(2)5(6)8(3)4/h11-13H,2-10H2,1H3;4-6H2,1-3H3;6H,1-4H3 |
| InChIKey | HBDPRNMMHHDSCR-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 95.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.69 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|