C16H24B2N2O8 — CID 158429979
1-ethenyl-5-methyl-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione;5-methyl-1-[(1R,2R)-2-methylcyclopropyl]-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione (PubChem CID 158429979) has the molecular formula C16H24B2N2O8 and a molecular weight of 394.00 g/mol. Its IUPAC name is 1-ethenyl-5-methyl-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione;5-methyl-1-[(1R,2R)-2-methylcyclopropyl]-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione.
| Compound Name | 1-ethenyl-5-methyl-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione;5-methyl-1-[(1R,2R)-2-methylcyclopropyl]-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione |
|---|---|
| PubChem CID | 158429979 |
| Molecular Formula | C16H24B2N2O8 |
| Molecular Weight | 394.00 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 1-ethenyl-5-methyl-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione;5-methyl-1-[(1R,2R)-2-methylcyclopropyl]-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione |
| SMILES | C=C[B-]12OC(=O)C[N+]1(C)CC(=O)O2.C[C@@H]1C[C@H]1[B-]12OC(=O)C[N+]1(C)CC(=O)O2 |
| InChI | InChI=1S/C9H14BNO4.C7H10BNO4/c1-6-3-7(6)10-11(2,4-8(12)14-10)5-9(13)15-10;1-3-8-9(2,4-6(10)12-8)5-7(11)13-8/h6-7H,3-5H2,1-2H3;3H,1,4-5H2,2H3/t6-,7-,10?,11?;/m1./s1 |
| InChIKey | HBNONJJTWZWQJW-BIBMEONPSA-N |
| XLogP | -0.89 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.00 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|