C11H18O3 — CID 85352913
2-ethenyl-4-methyl-9-oxabicyclo[3.3.1]nonane-1,5-diol (PubChem CID 85352913) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is 2-ethenyl-4-methyl-9-oxabicyclo[3.3.1]nonane-1,5-diol.
| Compound Name | 2-ethenyl-4-methyl-9-oxabicyclo[3.3.1]nonane-1,5-diol |
|---|---|
| PubChem CID | 85352913 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 2-ethenyl-4-methyl-9-oxabicyclo[3.3.1]nonane-1,5-diol |
| SMILES | C=CC1CC(C)C2(O)CCCC1(O)O2 |
| InChI | InChI=1S/C11H18O3/c1-3-9-7-8(2)10(12)5-4-6-11(9,13)14-10/h3,8-9,12-13H,1,4-7H2,2H3 |
| InChIKey | INTVWFROWRCATB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|