C9H13IO — CID 163840809
5-ethenyl-3,6-dimethyl-1λ3-iodacyclohex-6-en-2-one (PubChem CID 163840809) has the molecular formula C9H13IO and a molecular weight of 264.11 g/mol. Its IUPAC name is 5-ethenyl-3,6-dimethyl-1λ3-iodacyclohex-6-en-2-one.
| Compound Name | 5-ethenyl-3,6-dimethyl-1λ3-iodacyclohex-6-en-2-one |
|---|---|
| PubChem CID | 163840809 |
| Molecular Formula | C9H13IO |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | 5-ethenyl-3,6-dimethyl-1λ3-iodacyclohex-6-en-2-one |
| SMILES | C=CC1CC(C)C(=O)I=C1C |
| InChI | InChI=1S/C9H13IO/c1-4-8-5-6(2)9(11)10-7(8)3/h4,6,8H,1,5H2,2-3H3 |
| InChIKey | OLUVAQSVYKVAAG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|