C18H12I3P — CID 158456097
diphenyl-(2,3,4-triiodophenyl)phosphane (PubChem CID 158456097) has the molecular formula C18H12I3P and a molecular weight of 639.98 g/mol. Its IUPAC name is diphenyl-(2,3,4-triiodophenyl)phosphane.
| Compound Name | diphenyl-(2,3,4-triiodophenyl)phosphane |
|---|---|
| PubChem CID | 158456097 |
| Molecular Formula | C18H12I3P |
| Molecular Weight | 639.98 g/mol |
| Exact Mass | 639.78 |
| IUPAC Name | diphenyl-(2,3,4-triiodophenyl)phosphane |
| SMILES | Ic1ccc(P(c2ccccc2)c2ccccc2)c(I)c1I |
| InChI | InChI=1S/C18H12I3P/c19-15-11-12-16(18(21)17(15)20)22(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12H |
| InChIKey | HGMKXPFVPYARDS-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.98 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|