About 2-butan-2-yloxybutane;3-methyl-1H-imidazol-3-ium;tetrafluoroborate
2-butan-2-yloxybutane;3-methyl-1H-imidazol-3-ium;tetrafluoroborate (PubChem CID 158468851) has the molecular formula C12H25BF4N2O
and a molecular weight of 300.15 g/mol. Its IUPAC name is 2-butan-2-yloxybutane;3-methyl-1H-imidazol-3-ium;tetrafluoroborate.
Molecular Properties
| Compound Name | 2-butan-2-yloxybutane;3-methyl-1H-imidazol-3-ium;tetrafluoroborate |
| PubChem CID | 158468851 |
| Molecular Formula | C12H25BF4N2O |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 2-butan-2-yloxybutane;3-methyl-1H-imidazol-3-ium;tetrafluoroborate |
| SMILES | CCC(C)OC(C)CC.C[n+]1cc[nH]c1.F[B-](F)(F)F |
| InChI | InChI=1S/C8H18O.C4H6N2.BF4/c1-5-7(3)9-8(4)6-2;1-6-3-2-5-4-6;2-1(3,4)5/h7-8H,5-6H2,1-4H3;2-4H,1H3;/q;;-1/p+1 |
| InChIKey | HGCCYTRMTRWFJN-UHFFFAOYSA-O |
| XLogP | 3.74 |
| TPSA | 28.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-butan-2-yloxybutane;3-methyl-1H-imidazol-3-ium;tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yloxybutane;3-methyl-1H-imidazol-3-ium;tetrafluoroborate?
The IUPAC name of 2-butan-2-yloxybutane;3-methyl-1H-imidazol-3-ium;tetrafluoroborate (CID 158468851) is 2-butan-2-yloxybutane;3-methyl-1H-imidazol-3-ium;tetrafluoroborate.
What is the SMILES notation for 2-butan-2-yloxybutane;3-methyl-1H-imidazol-3-ium;tetrafluoroborate?
The canonical SMILES for 2-butan-2-yloxybutane;3-methyl-1H-imidazol-3-ium;tetrafluoroborate is CCC(C)OC(C)CC.C[n+]1cc[nH]c1.F[B-](F)(F)F.
What is the InChIKey of 2-butan-2-yloxybutane;3-methyl-1H-imidazol-3-ium;tetrafluoroborate?
The InChIKey is HGCCYTRMTRWFJN-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H18O.C4H6N2.BF4/c1-5-7(3)9-8(4)6-2;1-6-3-2-5-4-6;2-1(3,4)5/h7-8H,5-6H2,1-4H3;2-4H,1H3;/q;;-1/p+1.
What are the key properties of 2-butan-2-yloxybutane;3-methyl-1H-imidazol-3-ium;tetrafluoroborate?
2-butan-2-yloxybutane;3-methyl-1H-imidazol-3-ium;tetrafluoroborate has a molecular weight of 300.15 g/mol, XLogP of 3.74, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yloxybutane;3-methyl-1H-imidazol-3-ium;tetrafluoroborate is sourced from PubChem (CID 158468851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).