C40H45F3O8 — CID 158472550
[4-(1,1,1-trifluoropropan-2-yloxycarbonyl)-3,5-bis[(2,3,5-trimethylbenzoyl)oxy]cyclohexyl] 2,3,5-trimethylbenzoate (PubChem CID 158472550) has the molecular formula C40H45F3O8 and a molecular weight of 710.79 g/mol. Its IUPAC name is [4-(1,1,1-trifluoropropan-2-yloxycarbonyl)-3,5-bis[(2,3,5-trimethylbenzoyl)oxy]cyclohexyl] 2,3,5-trimethylbenzoate.
| Compound Name | [4-(1,1,1-trifluoropropan-2-yloxycarbonyl)-3,5-bis[(2,3,5-trimethylbenzoyl)oxy]cyclohexyl] 2,3,5-trimethylbenzoate |
|---|---|
| PubChem CID | 158472550 |
| Molecular Formula | C40H45F3O8 |
| Molecular Weight | 710.79 g/mol |
| Exact Mass | 710.31 |
| IUPAC Name | [4-(1,1,1-trifluoropropan-2-yloxycarbonyl)-3,5-bis[(2,3,5-trimethylbenzoyl)oxy]cyclohexyl] 2,3,5-trimethylbenzoate |
| SMILES | Cc1cc(C)c(C)c(C(=O)OC2CC(OC(=O)c3cc(C)cc(C)c3C)C(C(=O)OC(C)C(F)(F)F)C(OC(=O)c3cc(C)cc(C)c3C)C2)c1 |
| InChI | InChI=1S/C40H45F3O8/c1-19-11-22(4)25(7)30(14-19)36(44)49-29-17-33(50-37(45)31-15-20(2)12-23(5)26(31)8)35(39(47)48-28(10)40(41,42)43)34(18-29)51-38(46)32-16-21(3)13-24(6)27(32)9/h11-16,28-29,33-35H,17-18H2,1-10H3 |
| InChIKey | AXPAUDFRLLDWKQ-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.79 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|