C13H17N3O2Se — CID 158489350
(3R,4R,6R)-5-azido-2,4-dimethyl-6-phenylselanyloxan-3-ol (PubChem CID 158489350) has the molecular formula C13H17N3O2Se and a molecular weight of 326.26 g/mol. Its IUPAC name is (3R,4R,6R)-5-azido-2,4-dimethyl-6-phenylselanyloxan-3-ol.
| Compound Name | (3R,4R,6R)-5-azido-2,4-dimethyl-6-phenylselanyloxan-3-ol |
|---|---|
| PubChem CID | 158489350 |
| Molecular Formula | C13H17N3O2Se |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | (3R,4R,6R)-5-azido-2,4-dimethyl-6-phenylselanyloxan-3-ol |
| SMILES | CC1O[C@H]([Se]c2ccccc2)C(N=[N+]=[N-])[C@@H](C)[C@H]1O |
| InChI | InChI=1S/C13H17N3O2Se/c1-8-11(15-16-14)13(18-9(2)12(8)17)19-10-6-4-3-5-7-10/h3-9,11-13,17H,1-2H3/t8-,9?,11?,12-,13-/m1/s1 |
| InChIKey | HIMRAZYLJKHSIX-DTAGJMRGSA-N |
| XLogP | 1.44 |
| TPSA | 78.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|