C44H34N12O2 — CID 158555112
3-(2-methylphenyl)-N-(3-nitrophenyl)-[1,2,4]triazolo[3,4-a]phthalazin-6-amine;3-N-[3-(2-methylphenyl)-[1,2,4]triazolo[3,4-a]phthalazin-6-yl]benzene-1,3-diamine (PubChem CID 158555112) has the molecular formula C44H34N12O2 and a molecular weight of 762.84 g/mol. Its IUPAC name is 3-(2-methylphenyl)-N-(3-nitrophenyl)-[1,2,4]triazolo[3,4-a]phthalazin-6-amine;3-N-[3-(2-methylphenyl)-[1,2,4]triazolo[3,4-a]phthalazin-6-yl]benzene-1,3-diamine.
| Compound Name | 3-(2-methylphenyl)-N-(3-nitrophenyl)-[1,2,4]triazolo[3,4-a]phthalazin-6-amine;3-N-[3-(2-methylphenyl)-[1,2,4]triazolo[3,4-a]phthalazin-6-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 158555112 |
| Molecular Formula | C44H34N12O2 |
| Molecular Weight | 762.84 g/mol |
| Exact Mass | 762.29 |
| IUPAC Name | 3-(2-methylphenyl)-N-(3-nitrophenyl)-[1,2,4]triazolo[3,4-a]phthalazin-6-amine;3-N-[3-(2-methylphenyl)-[1,2,4]triazolo[3,4-a]phthalazin-6-yl]benzene-1,3-diamine |
| SMILES | Cc1ccccc1-c1nnc2c3ccccc3c(Nc3cccc(N)c3)nn12.Cc1ccccc1-c1nnc2c3ccccc3c(Nc3cccc([N+](=O)[O-])c3)nn12 |
| InChI | InChI=1S/C22H16N6O2.C22H18N6/c1-14-7-2-3-10-17(14)21-24-25-22-19-12-5-4-11-18(19)20(26-27(21)22)23-15-8-6-9-16(13-15)28(29)30;1-14-7-2-3-10-17(14)21-25-26-22-19-12-5-4-11-18(19)20(27-28(21)22)24-16-9-6-8-15(23)13-16/h2-13H,1H3,(H,23,26);2-13H,23H2,1H3,(H,24,27) |
| InChIKey | HQEQMXUWWWVVQE-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 179.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.84 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|