C12H13NO3 — CID 158558251
3-hydroxy-4-(4-methylanilino)cyclobut-3-ene-1,2-dione;methane (PubChem CID 158558251) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is 3-hydroxy-4-(4-methylanilino)cyclobut-3-ene-1,2-dione;methane.
| Compound Name | 3-hydroxy-4-(4-methylanilino)cyclobut-3-ene-1,2-dione;methane |
|---|---|
| PubChem CID | 158558251 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 3-hydroxy-4-(4-methylanilino)cyclobut-3-ene-1,2-dione;methane |
| SMILES | C.Cc1ccc(Nc2c(O)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C11H9NO3.CH4/c1-6-2-4-7(5-3-6)12-8-9(13)11(15)10(8)14;/h2-5,12-13H,1H3;1H4 |
| InChIKey | HQOFLMBMTGGKLH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|