C40H40BClN2O2 — CID 158560718
5-chloro-2-(3,5-dimethylphenyl)quinoline;2-(3,5-dimethylphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (PubChem CID 158560718) has the molecular formula C40H40BClN2O2 and a molecular weight of 627.04 g/mol. Its IUPAC name is 5-chloro-2-(3,5-dimethylphenyl)quinoline;2-(3,5-dimethylphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline.
| Compound Name | 5-chloro-2-(3,5-dimethylphenyl)quinoline;2-(3,5-dimethylphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
|---|---|
| PubChem CID | 158560718 |
| Molecular Formula | C40H40BClN2O2 |
| Molecular Weight | 627.04 g/mol |
| Exact Mass | 626.29 |
| IUPAC Name | 5-chloro-2-(3,5-dimethylphenyl)quinoline;2-(3,5-dimethylphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| SMILES | Cc1cc(C)cc(-c2ccc3c(B4OC(C)(C)C(C)(C)O4)cccc3n2)c1.Cc1cc(C)cc(-c2ccc3c(Cl)cccc3n2)c1 |
| InChI | InChI=1S/C23H26BNO2.C17H14ClN/c1-15-12-16(2)14-17(13-15)20-11-10-18-19(8-7-9-21(18)25-20)24-26-22(3,4)23(5,6)27-24;1-11-8-12(2)10-13(9-11)16-7-6-14-15(18)4-3-5-17(14)19-16/h7-14H,1-6H3;3-10H,1-2H3 |
| InChIKey | HQVUKFCIESFBOT-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.04 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|