C36H46 — CID 158565582
3-cyclohex-3-en-1-yl-1-methyl-1,2,3,4-tetrahydropentalene;1,2,3,4,5,6,7,8-octamethyl-9H-fluorene (PubChem CID 158565582) has the molecular formula C36H46 and a molecular weight of 478.76 g/mol. Its IUPAC name is 3-cyclohex-3-en-1-yl-1-methyl-1,2,3,4-tetrahydropentalene;1,2,3,4,5,6,7,8-octamethyl-9H-fluorene.
| Compound Name | 3-cyclohex-3-en-1-yl-1-methyl-1,2,3,4-tetrahydropentalene;1,2,3,4,5,6,7,8-octamethyl-9H-fluorene |
|---|---|
| PubChem CID | 158565582 |
| Molecular Formula | C36H46 |
| Molecular Weight | 478.76 g/mol |
| Exact Mass | 478.36 |
| IUPAC Name | 3-cyclohex-3-en-1-yl-1-methyl-1,2,3,4-tetrahydropentalene;1,2,3,4,5,6,7,8-octamethyl-9H-fluorene |
| SMILES | CC1CC(C2CC=CCC2)C2=C1C=CC2.Cc1c(C)c(C)c2c(c1C)Cc1c(C)c(C)c(C)c(C)c1-2 |
| InChI | InChI=1S/C21H26.C15H20/c1-10-12(3)16(7)20-18(14(10)5)9-19-15(6)11(2)13(4)17(8)21(19)20;1-11-10-15(12-6-3-2-4-7-12)14-9-5-8-13(11)14/h9H2,1-8H3;2-3,5,8,11-12,15H,4,6-7,9-10H2,1H3 |
| InChIKey | HRKXKZMAGZNXRC-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.76 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|