C16H32N2O2Y-2 — CID 158601152
butanehydrazide;4-methanidyl-2,2,6,6-tetramethylheptan-3-one;yttrium (PubChem CID 158601152) has the molecular formula C16H32N2O2Y-2 and a molecular weight of 373.35 g/mol. Its IUPAC name is butanehydrazide;4-methanidyl-2,2,6,6-tetramethylheptan-3-one;yttrium.
| Compound Name | butanehydrazide;4-methanidyl-2,2,6,6-tetramethylheptan-3-one;yttrium |
|---|---|
| PubChem CID | 158601152 |
| Molecular Formula | C16H32N2O2Y-2 |
| Molecular Weight | 373.35 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | butanehydrazide;4-methanidyl-2,2,6,6-tetramethylheptan-3-one;yttrium |
| SMILES | [CH2-]C(CC(C)(C)C)C(=O)C(C)(C)C.[CH2-]CCC(=O)NN.[Y] |
| InChI | InChI=1S/C12H23O.C4H9N2O.Y/c1-9(8-11(2,3)4)10(13)12(5,6)7;1-2-3-4(7)6-5;/h9H,1,8H2,2-7H3;1-3,5H2,(H,6,7);/q2*-1; |
| InChIKey | MACZQNYJLLGNKO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|