C28H22F3N3O2 — CID 158638214
6,7-dimethyl-N-(3-naphthalen-1-yloxyphenyl)quinazolin-4-amine;2,2,2-trifluoroacetaldehyde (PubChem CID 158638214) has the molecular formula C28H22F3N3O2 and a molecular weight of 489.50 g/mol. Its IUPAC name is 6,7-dimethyl-N-(3-naphthalen-1-yloxyphenyl)quinazolin-4-amine;2,2,2-trifluoroacetaldehyde.
| Compound Name | 6,7-dimethyl-N-(3-naphthalen-1-yloxyphenyl)quinazolin-4-amine;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 158638214 |
| Molecular Formula | C28H22F3N3O2 |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 6,7-dimethyl-N-(3-naphthalen-1-yloxyphenyl)quinazolin-4-amine;2,2,2-trifluoroacetaldehyde |
| SMILES | Cc1cc2ncnc(Nc3cccc(Oc4cccc5ccccc45)c3)c2cc1C.O=CC(F)(F)F |
| InChI | InChI=1S/C26H21N3O.C2HF3O/c1-17-13-23-24(14-18(17)2)27-16-28-26(23)29-20-9-6-10-21(15-20)30-25-12-5-8-19-7-3-4-11-22(19)25;3-2(4,5)1-6/h3-16H,1-2H3,(H,27,28,29);1H |
| InChIKey | IAAQEGRWHQPWGD-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|