C44H82N2O6 — CID 158645192
methyl 2-(octadecanoylamino)prop-2-enoate;2-(octadecanoylamino)but-2-enoic acid (PubChem CID 158645192) has the molecular formula C44H82N2O6 and a molecular weight of 735.15 g/mol. Its IUPAC name is methyl 2-(octadecanoylamino)prop-2-enoate;2-(octadecanoylamino)but-2-enoic acid.
| Compound Name | methyl 2-(octadecanoylamino)prop-2-enoate;2-(octadecanoylamino)but-2-enoic acid |
|---|---|
| PubChem CID | 158645192 |
| Molecular Formula | C44H82N2O6 |
| Molecular Weight | 735.15 g/mol |
| Exact Mass | 734.62 |
| IUPAC Name | methyl 2-(octadecanoylamino)prop-2-enoate;2-(octadecanoylamino)but-2-enoic acid |
| SMILES | C=C(NC(=O)CCCCCCCCCCCCCCCCC)C(=O)OC.CC=C(NC(=O)CCCCCCCCCCCCCCCCC)C(=O)O |
| InChI | InChI=1S/2C22H41NO3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(24)23-20(2)22(25)26-3;1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(24)23-20(4-2)22(25)26/h2,4-19H2,1,3H3,(H,23,24);4H,3,5-19H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | IAWJBZAKGRIJJS-UHFFFAOYSA-N |
| XLogP | 12.40 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.15 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|