C28H50N2O6 — CID 162067826
2-(decanoylamino)but-2-enoic acid;methyl 2-(decanoylamino)prop-2-enoate (PubChem CID 162067826) has the molecular formula C28H50N2O6 and a molecular weight of 510.72 g/mol. Its IUPAC name is 2-(decanoylamino)but-2-enoic acid;methyl 2-(decanoylamino)prop-2-enoate.
| Compound Name | 2-(decanoylamino)but-2-enoic acid;methyl 2-(decanoylamino)prop-2-enoate |
|---|---|
| PubChem CID | 162067826 |
| Molecular Formula | C28H50N2O6 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 510.37 |
| IUPAC Name | 2-(decanoylamino)but-2-enoic acid;methyl 2-(decanoylamino)prop-2-enoate |
| SMILES | C=C(NC(=O)CCCCCCCCC)C(=O)OC.CC=C(NC(=O)CCCCCCCCC)C(=O)O |
| InChI | InChI=1S/2C14H25NO3/c1-4-5-6-7-8-9-10-11-13(16)15-12(2)14(17)18-3;1-3-5-6-7-8-9-10-11-13(16)15-12(4-2)14(17)18/h2,4-11H2,1,3H3,(H,15,16);4H,3,5-11H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | ZARLMZUHDQWLIH-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|