C37H55N7O10 — CID 158661315
2-[5-[3-(diaminomethylideneamino)propyl]-2-(6,10-dioxotridecyl)-14-[(4-hydroxyphenyl)methyl]-3,6,9,12,15-pentaoxo-1,4,7,10-tetrazacyclopentadec-11-yl]acetic acid (PubChem CID 158661315) has the molecular formula C37H55N7O10 and a molecular weight of 757.89 g/mol. Its IUPAC name is 2-[5-[3-(diaminomethylideneamino)propyl]-2-(6,10-dioxotridecyl)-14-[(4-hydroxyphenyl)methyl]-3,6,9,12,15-pentaoxo-1,4,7,10-tetrazacyclopentadec-11-yl]acetic acid.
| Compound Name | 2-[5-[3-(diaminomethylideneamino)propyl]-2-(6,10-dioxotridecyl)-14-[(4-hydroxyphenyl)methyl]-3,6,9,12,15-pentaoxo-1,4,7,10-tetrazacyclopentadec-11-yl]acetic acid |
|---|---|
| PubChem CID | 158661315 |
| Molecular Formula | C37H55N7O10 |
| Molecular Weight | 757.89 g/mol |
| Exact Mass | 757.40 |
| IUPAC Name | 2-[5-[3-(diaminomethylideneamino)propyl]-2-(6,10-dioxotridecyl)-14-[(4-hydroxyphenyl)methyl]-3,6,9,12,15-pentaoxo-1,4,7,10-tetrazacyclopentadec-11-yl]acetic acid |
| SMILES | CCCC(=O)CCCC(=O)CCCCCC1NC(=O)C(Cc2ccc(O)cc2)CC(=O)C(CC(=O)O)NC(=O)CNC(=O)C(CCCN=C(N)N)NC1=O |
| InChI | InChI=1S/C37H55N7O10/c1-2-8-25(45)10-6-11-26(46)9-4-3-5-12-29-36(54)44-28(13-7-18-40-37(38)39)35(53)41-22-32(49)42-30(21-33(50)51)31(48)20-24(34(52)43-29)19-23-14-16-27(47)17-15-23/h14-17,24,28-30,47H,2-13,18-22H2,1H3,(H,41,53)(H,42,49)(H,43,52)(H,44,54)(H,50,51)(H4,38,39,40) |
| InChIKey | KAWYGEFOQMEMMQ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 289.54 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.89 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|