C33H51N7O7 — CID 172606373
2-[(5S,8R,11S,14R,16R)-8-benzyl-16-[3-(diaminomethylideneamino)propyl]-14,15-dimethyl-3,6,9,12,17-pentaoxo-11-pentyl-1,4,7,10-tetrazacycloheptadec-5-yl]acetic acid (PubChem CID 172606373) has the molecular formula C33H51N7O7 and a molecular weight of 657.81 g/mol. Its IUPAC name is 2-[(5S,8R,11S,14R,16R)-8-benzyl-16-[3-(diaminomethylideneamino)propyl]-14,15-dimethyl-3,6,9,12,17-pentaoxo-11-pentyl-1,4,7,10-tetrazacycloheptadec-5-yl]acetic acid.
| Compound Name | 2-[(5S,8R,11S,14R,16R)-8-benzyl-16-[3-(diaminomethylideneamino)propyl]-14,15-dimethyl-3,6,9,12,17-pentaoxo-11-pentyl-1,4,7,10-tetrazacycloheptadec-5-yl]acetic acid |
|---|---|
| PubChem CID | 172606373 |
| Molecular Formula | C33H51N7O7 |
| Molecular Weight | 657.81 g/mol |
| Exact Mass | 657.38 |
| IUPAC Name | 2-[(5S,8R,11S,14R,16R)-8-benzyl-16-[3-(diaminomethylideneamino)propyl]-14,15-dimethyl-3,6,9,12,17-pentaoxo-11-pentyl-1,4,7,10-tetrazacycloheptadec-5-yl]acetic acid |
| SMILES | CCCCC[C@@H]1NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](CC(=O)O)NC(=O)CNC(=O)[C@H](CCCN=C(N)N)C(C)[C@H](C)CC1=O |
| InChI | InChI=1S/C33H51N7O7/c1-4-5-7-14-24-27(41)16-20(2)21(3)23(13-10-15-36-33(34)35)30(45)37-19-28(42)38-26(18-29(43)44)32(47)40-25(31(46)39-24)17-22-11-8-6-9-12-22/h6,8-9,11-12,20-21,23-26H,4-5,7,10,13-19H2,1-3H3,(H,37,45)(H,38,42)(H,39,46)(H,40,47)(H,43,44)(H4,34,35,36)/t20-,21?,23-,24+,25-,26+/m1/s1 |
| InChIKey | ZHFBFRJYZIUXOH-MAEMJWFSSA-N |
| XLogP | 0.77 |
| TPSA | 235.17 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.81 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|