C29H19N7O4S — CID 15866992
3'-(2,4-dinitrophenyl)-5',12-diphenylspiro[1,2,9-triazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7,11-pentaene-10,2'-1,3,4-thiadiazole] (PubChem CID 15866992) has the molecular formula C29H19N7O4S and a molecular weight of 561.58 g/mol. Its IUPAC name is 3'-(2,4-dinitrophenyl)-5',12-diphenylspiro[1,2,9-triazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7,11-pentaene-10,2'-1,3,4-thiadiazole].
| Compound Name | 3'-(2,4-dinitrophenyl)-5',12-diphenylspiro[1,2,9-triazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7,11-pentaene-10,2'-1,3,4-thiadiazole] |
|---|---|
| PubChem CID | 15866992 |
| Molecular Formula | C29H19N7O4S |
| Molecular Weight | 561.58 g/mol |
| Exact Mass | 561.12 |
| IUPAC Name | 3'-(2,4-dinitrophenyl)-5',12-diphenylspiro[1,2,9-triazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7,11-pentaene-10,2'-1,3,4-thiadiazole] |
| SMILES | O=[N+]([O-])c1ccc(N2N=C(c3ccccc3)SC23C=C(c2ccccc2)n2ncc4cccc(c42)N3)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H19N7O4S/c37-35(38)22-14-15-24(25(16-22)36(39)40)34-29(41-28(32-34)20-10-5-2-6-11-20)17-26(19-8-3-1-4-9-19)33-27-21(18-30-33)12-7-13-23(27)31-29/h1-18,31H |
| InChIKey | AGUYNJTZZWQSQX-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 131.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.58 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|