C20H14N4O2S2 — CID 46502748
5-(4-nitrophenyl)-3-phenylspiro[1,3,4-thiadiazole-2,2'-3H-1,3-benzothiazole] (PubChem CID 46502748) has the molecular formula C20H14N4O2S2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 5-(4-nitrophenyl)-3-phenylspiro[1,3,4-thiadiazole-2,2'-3H-1,3-benzothiazole].
| Compound Name | 5-(4-nitrophenyl)-3-phenylspiro[1,3,4-thiadiazole-2,2'-3H-1,3-benzothiazole] |
|---|---|
| PubChem CID | 46502748 |
| Molecular Formula | C20H14N4O2S2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 5-(4-nitrophenyl)-3-phenylspiro[1,3,4-thiadiazole-2,2'-3H-1,3-benzothiazole] |
| SMILES | O=[N+]([O-])c1ccc(C2=NN(c3ccccc3)C3(Nc4ccccc4S3)S2)cc1 |
| InChI | InChI=1S/C20H14N4O2S2/c25-24(26)16-12-10-14(11-13-16)19-22-23(15-6-2-1-3-7-15)20(28-19)21-17-8-4-5-9-18(17)27-20/h1-13,21H |
| InChIKey | PBCSRDIWHWHMOM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|