C27H27N5O — CID 158671985
5-(4-amino-3-methylanilino)-4-(4-aminophenyl)imino-2-[(4-aminophenyl)methyl]-3-methylcyclohexa-2,5-dien-1-one (PubChem CID 158671985) has the molecular formula C27H27N5O and a molecular weight of 437.55 g/mol. Its IUPAC name is 5-(4-amino-3-methylanilino)-4-(4-aminophenyl)imino-2-[(4-aminophenyl)methyl]-3-methylcyclohexa-2,5-dien-1-one.
| Compound Name | 5-(4-amino-3-methylanilino)-4-(4-aminophenyl)imino-2-[(4-aminophenyl)methyl]-3-methylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 158671985 |
| Molecular Formula | C27H27N5O |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 5-(4-amino-3-methylanilino)-4-(4-aminophenyl)imino-2-[(4-aminophenyl)methyl]-3-methylcyclohexa-2,5-dien-1-one |
| SMILES | CC1=C(Cc2ccc(N)cc2)C(=O)C=C(Nc2ccc(N)c(C)c2)/C1=N/c1ccc(N)cc1 |
| InChI | InChI=1S/C27H27N5O/c1-16-13-22(11-12-24(16)30)31-25-15-26(33)23(14-18-3-5-19(28)6-4-18)17(2)27(25)32-21-9-7-20(29)8-10-21/h3-13,15,31H,14,28-30H2,1-2H3/b32-27+ |
| InChIKey | OIHYIVSNAHQXNY-QVAGMWBUSA-N |
| XLogP | 4.95 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|