C53H46O8 — CID 158692976
1-O-benzhydryl 4-O-(9H-fluoren-9-ylmethyl) (2E)-2-ethylidenebutanedioate;(E)-2-[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]but-2-enoic acid (PubChem CID 158692976) has the molecular formula C53H46O8 and a molecular weight of 810.94 g/mol. Its IUPAC name is 1-O-benzhydryl 4-O-(9H-fluoren-9-ylmethyl) (2E)-2-ethylidenebutanedioate;(E)-2-[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]but-2-enoic acid.
| Compound Name | 1-O-benzhydryl 4-O-(9H-fluoren-9-ylmethyl) (2E)-2-ethylidenebutanedioate;(E)-2-[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]but-2-enoic acid |
|---|---|
| PubChem CID | 158692976 |
| Molecular Formula | C53H46O8 |
| Molecular Weight | 810.94 g/mol |
| Exact Mass | 810.32 |
| IUPAC Name | 1-O-benzhydryl 4-O-(9H-fluoren-9-ylmethyl) (2E)-2-ethylidenebutanedioate;(E)-2-[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]but-2-enoic acid |
| SMILES | C/C=C(\CC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O.C/C=C(\CC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H28O4.C20H18O4/c1-2-23(33(35)37-32(24-13-5-3-6-14-24)25-15-7-4-8-16-25)21-31(34)36-22-30-28-19-11-9-17-26(28)27-18-10-12-20-29(27)30;1-2-13(20(22)23)11-19(21)24-12-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h2-20,30,32H,21-22H2,1H3;2-10,18H,11-12H2,1H3,(H,22,23)/b23-2+;13-2+ |
| InChIKey | IGOWFEIBZSYTBZ-RXHOZHBSSA-N |
| XLogP | 10.77 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.94 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|