C15H26O5Si — CID 158705227
3-[dimethyl-[1-(2-methylprop-2-enoyloxy)ethoxy]silyl]propyl 2-methylprop-2-enoate (PubChem CID 158705227) has the molecular formula C15H26O5Si and a molecular weight of 314.45 g/mol. Its IUPAC name is 3-[dimethyl-[1-(2-methylprop-2-enoyloxy)ethoxy]silyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[dimethyl-[1-(2-methylprop-2-enoyloxy)ethoxy]silyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 158705227 |
| Molecular Formula | C15H26O5Si |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 3-[dimethyl-[1-(2-methylprop-2-enoyloxy)ethoxy]silyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](C)(C)OC(C)OC(=O)C(=C)C |
| InChI | InChI=1S/C15H26O5Si/c1-11(2)14(16)18-9-8-10-21(6,7)20-13(5)19-15(17)12(3)4/h13H,1,3,8-10H2,2,4-7H3 |
| InChIKey | IIALGKXWDFKGDW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|