C45H37Cl3O3 — CID 158723516
bis((1S,3S)-6-chloro-3-(2,3,4,5,6-pentadeuteriophenyl)-2,3-dihydro-1H-inden-1-ol);6-chloro-3-(2,3,4,5,6-pentadeuteriophenyl)-2,3-dihydroinden-1-one (PubChem CID 158723516) has the molecular formula C45H37Cl3O3 and a molecular weight of 747.24 g/mol. Its IUPAC name is bis((1S,3S)-6-chloro-3-(2,3,4,5,6-pentadeuteriophenyl)-2,3-dihydro-1H-inden-1-ol);6-chloro-3-(2,3,4,5,6-pentadeuteriophenyl)-2,3-dihydroinden-1-one.
| Compound Name | bis((1S,3S)-6-chloro-3-(2,3,4,5,6-pentadeuteriophenyl)-2,3-dihydro-1H-inden-1-ol);6-chloro-3-(2,3,4,5,6-pentadeuteriophenyl)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 158723516 |
| Molecular Formula | C45H37Cl3O3 |
| Molecular Weight | 747.24 g/mol |
| Exact Mass | 745.27 |
| IUPAC Name | bis((1S,3S)-6-chloro-3-(2,3,4,5,6-pentadeuteriophenyl)-2,3-dihydro-1H-inden-1-ol);6-chloro-3-(2,3,4,5,6-pentadeuteriophenyl)-2,3-dihydroinden-1-one |
| SMILES | [2H]c1c([2H])c([2H])c(C2CC(=O)c3cc(Cl)ccc32)c([2H])c1[2H].[2H]c1c([2H])c([2H])c([C@@H]2C[C@H](O)c3cc(Cl)ccc32)c([2H])c1[2H].[2H]c1c([2H])c([2H])c([C@@H]2C[C@H](O)c3cc(Cl)ccc32)c([2H])c1[2H] |
| InChI | InChI=1S/2C15H13ClO.C15H11ClO/c3*16-11-6-7-12-13(9-15(17)14(12)8-11)10-4-2-1-3-5-10/h2*1-8,13,15,17H,9H2;1-8,13H,9H2/t2*13-,15-;/m00./s1/i3*1D,2D,3D,4D,5D |
| InChIKey | IKFDJUHRLUASAL-ZZTGYJTGSA-N |
| XLogP | 11.88 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.24 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |