C23H25F5O8S — CID 158735021
2-[2-(adamantane-1-carbonyloxy)-1,1,1-trifluoro-3-(4-methylphenoxy)-3-oxopropan-2-yl]oxy-1,1-difluoroethanesulfonic acid (PubChem CID 158735021) has the molecular formula C23H25F5O8S and a molecular weight of 556.50 g/mol. Its IUPAC name is 2-[2-(adamantane-1-carbonyloxy)-1,1,1-trifluoro-3-(4-methylphenoxy)-3-oxopropan-2-yl]oxy-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-[2-(adamantane-1-carbonyloxy)-1,1,1-trifluoro-3-(4-methylphenoxy)-3-oxopropan-2-yl]oxy-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 158735021 |
| Molecular Formula | C23H25F5O8S |
| Molecular Weight | 556.50 g/mol |
| Exact Mass | 556.12 |
| IUPAC Name | 2-[2-(adamantane-1-carbonyloxy)-1,1,1-trifluoro-3-(4-methylphenoxy)-3-oxopropan-2-yl]oxy-1,1-difluoroethanesulfonic acid |
| SMILES | Cc1ccc(OC(=O)C(OCC(F)(F)S(=O)(=O)O)(OC(=O)C23CC4CC(CC(C4)C2)C3)C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H25F5O8S/c1-13-2-4-17(5-3-13)35-19(30)22(23(26,27)28,34-12-21(24,25)37(31,32)33)36-18(29)20-9-14-6-15(10-20)8-16(7-14)11-20/h2-5,14-16H,6-12H2,1H3,(H,31,32,33) |
| InChIKey | PJBXXPJPTYJCMQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|