About 2-(dimethylamino)ethyl acetate;2-(dimethylamino)-N-methylacetamide
2-(dimethylamino)ethyl acetate;2-(dimethylamino)-N-methylacetamide (PubChem CID 158740305) has the molecular formula C11H25N3O3
and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl acetate;2-(dimethylamino)-N-methylacetamide.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl acetate;2-(dimethylamino)-N-methylacetamide |
| PubChem CID | 158740305 |
| Molecular Formula | C11H25N3O3 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 2-(dimethylamino)ethyl acetate;2-(dimethylamino)-N-methylacetamide |
| SMILES | CC(=O)OCCN(C)C.CNC(=O)CN(C)C |
| InChI | InChI=1S/C6H13NO2.C5H12N2O/c1-6(8)9-5-4-7(2)3;1-6-5(8)4-7(2)3/h4-5H2,1-3H3;4H2,1-3H3,(H,6,8) |
| InChIKey | IMFBRMIVLSOUSJ-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(dimethylamino)ethyl acetate;2-(dimethylamino)-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl acetate;2-(dimethylamino)-N-methylacetamide?
The IUPAC name of 2-(dimethylamino)ethyl acetate;2-(dimethylamino)-N-methylacetamide (CID 158740305) is 2-(dimethylamino)ethyl acetate;2-(dimethylamino)-N-methylacetamide.
What is the SMILES notation for 2-(dimethylamino)ethyl acetate;2-(dimethylamino)-N-methylacetamide?
The canonical SMILES for 2-(dimethylamino)ethyl acetate;2-(dimethylamino)-N-methylacetamide is CC(=O)OCCN(C)C.CNC(=O)CN(C)C.
What is the InChIKey of 2-(dimethylamino)ethyl acetate;2-(dimethylamino)-N-methylacetamide?
The InChIKey is IMFBRMIVLSOUSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2.C5H12N2O/c1-6(8)9-5-4-7(2)3;1-6-5(8)4-7(2)3/h4-5H2,1-3H3;4H2,1-3H3,(H,6,8).
What are the key properties of 2-(dimethylamino)ethyl acetate;2-(dimethylamino)-N-methylacetamide?
2-(dimethylamino)ethyl acetate;2-(dimethylamino)-N-methylacetamide has a molecular weight of 247.34 g/mol, XLogP of -0.59, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl acetate;2-(dimethylamino)-N-methylacetamide is sourced from PubChem (CID 158740305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).