About benzhydrylphosphinous acid
benzhydrylphosphinous acid (PubChem CID 158752392) has the molecular formula C13H13OP
and a molecular weight of 216.22 g/mol. Its IUPAC name is benzhydrylphosphinous acid.
Molecular Properties
| Compound Name | benzhydrylphosphinous acid |
| PubChem CID | 158752392 |
| Molecular Formula | C13H13OP |
| Molecular Weight | 216.22 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | benzhydrylphosphinous acid |
| SMILES | OPC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H13OP/c14-15-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13-15H |
| InChIKey | MJACPFACIODZOH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.22 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze benzhydrylphosphinous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzhydrylphosphinous acid?
The IUPAC name of benzhydrylphosphinous acid (CID 158752392) is benzhydrylphosphinous acid.
What is the SMILES notation for benzhydrylphosphinous acid?
The canonical SMILES for benzhydrylphosphinous acid is OPC(c1ccccc1)c1ccccc1.
What is the InChIKey of benzhydrylphosphinous acid?
The InChIKey is MJACPFACIODZOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13OP/c14-15-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13-15H.
What are the key properties of benzhydrylphosphinous acid?
benzhydrylphosphinous acid has a molecular weight of 216.22 g/mol, XLogP of 3.36, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzhydrylphosphinous acid is sourced from PubChem (CID 158752392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).