About 3-(diethoxymethylsilyl)propan-1-amine;4-oxobutanoic acid
3-(diethoxymethylsilyl)propan-1-amine;4-oxobutanoic acid (PubChem CID 158760042) has the molecular formula C12H27NO5Si
and a molecular weight of 293.44 g/mol. Its IUPAC name is 3-(diethoxymethylsilyl)propan-1-amine;4-oxobutanoic acid.
Molecular Properties
| Compound Name | 3-(diethoxymethylsilyl)propan-1-amine;4-oxobutanoic acid |
| PubChem CID | 158760042 |
| Molecular Formula | C12H27NO5Si |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 3-(diethoxymethylsilyl)propan-1-amine;4-oxobutanoic acid |
| SMILES | CCOC(OCC)[SiH2]CCCN.O=CCCC(=O)O |
| InChI | InChI=1S/C8H21NO2Si.C4H6O3/c1-3-10-8(11-4-2)12-7-5-6-9;5-3-1-2-4(6)7/h8H,3-7,9,12H2,1-2H3;3H,1-2H2,(H,6,7) |
| InChIKey | IOOADOJZCORJFT-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-(diethoxymethylsilyl)propan-1-amine;4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(diethoxymethylsilyl)propan-1-amine;4-oxobutanoic acid?
The IUPAC name of 3-(diethoxymethylsilyl)propan-1-amine;4-oxobutanoic acid (CID 158760042) is 3-(diethoxymethylsilyl)propan-1-amine;4-oxobutanoic acid.
What is the SMILES notation for 3-(diethoxymethylsilyl)propan-1-amine;4-oxobutanoic acid?
The canonical SMILES for 3-(diethoxymethylsilyl)propan-1-amine;4-oxobutanoic acid is CCOC(OCC)[SiH2]CCCN.O=CCCC(=O)O.
What is the InChIKey of 3-(diethoxymethylsilyl)propan-1-amine;4-oxobutanoic acid?
The InChIKey is IOOADOJZCORJFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H21NO2Si.C4H6O3/c1-3-10-8(11-4-2)12-7-5-6-9;5-3-1-2-4(6)7/h8H,3-7,9,12H2,1-2H3;3H,1-2H2,(H,6,7).
What are the key properties of 3-(diethoxymethylsilyl)propan-1-amine;4-oxobutanoic acid?
3-(diethoxymethylsilyl)propan-1-amine;4-oxobutanoic acid has a molecular weight of 293.44 g/mol, XLogP of 0.33, 11 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(diethoxymethylsilyl)propan-1-amine;4-oxobutanoic acid is sourced from PubChem (CID 158760042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).