About 5-[4-[2,2-diphenyl-1-[4-(4H-pyrazol-3-yl)phenyl]ethenyl]phenyl]-2H-tetrazole
5-[4-[2,2-diphenyl-1-[4-(4H-pyrazol-3-yl)phenyl]ethenyl]phenyl]-2H-tetrazole (PubChem CID 158761008) has the molecular formula C30H22N6
and a molecular weight of 466.55 g/mol. Its IUPAC name is 5-[4-[2,2-diphenyl-1-[4-(4H-pyrazol-3-yl)phenyl]ethenyl]phenyl]-2H-tetrazole.
Molecular Properties
| Compound Name | 5-[4-[2,2-diphenyl-1-[4-(4H-pyrazol-3-yl)phenyl]ethenyl]phenyl]-2H-tetrazole |
| PubChem CID | 158761008 |
| Molecular Formula | C30H22N6 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 5-[4-[2,2-diphenyl-1-[4-(4H-pyrazol-3-yl)phenyl]ethenyl]phenyl]-2H-tetrazole |
| SMILES | C1=NN=C(c2ccc(C(=C(c3ccccc3)c3ccccc3)c3ccc(-c4nn[nH]n4)cc3)cc2)C1 |
| InChI | InChI=1S/C30H22N6/c1-3-7-22(8-4-1)28(23-9-5-2-6-10-23)29(24-13-11-21(12-14-24)27-19-20-31-32-27)25-15-17-26(18-16-25)30-33-35-36-34-30/h1-18,20H,19H2,(H,33,34,35,36) |
| InChIKey | MABFBVHEWRKLDD-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-[2,2-diphenyl-1-[4-(4H-pyrazol-3-yl)phenyl]ethenyl]phenyl]-2H-tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-[2,2-diphenyl-1-[4-(4H-pyrazol-3-yl)phenyl]ethenyl]phenyl]-2H-tetrazole?
The IUPAC name of 5-[4-[2,2-diphenyl-1-[4-(4H-pyrazol-3-yl)phenyl]ethenyl]phenyl]-2H-tetrazole (CID 158761008) is 5-[4-[2,2-diphenyl-1-[4-(4H-pyrazol-3-yl)phenyl]ethenyl]phenyl]-2H-tetrazole.
What is the SMILES notation for 5-[4-[2,2-diphenyl-1-[4-(4H-pyrazol-3-yl)phenyl]ethenyl]phenyl]-2H-tetrazole?
The canonical SMILES for 5-[4-[2,2-diphenyl-1-[4-(4H-pyrazol-3-yl)phenyl]ethenyl]phenyl]-2H-tetrazole is C1=NN=C(c2ccc(C(=C(c3ccccc3)c3ccccc3)c3ccc(-c4nn[nH]n4)cc3)cc2)C1.
What is the InChIKey of 5-[4-[2,2-diphenyl-1-[4-(4H-pyrazol-3-yl)phenyl]ethenyl]phenyl]-2H-tetrazole?
The InChIKey is MABFBVHEWRKLDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H22N6/c1-3-7-22(8-4-1)28(23-9-5-2-6-10-23)29(24-13-11-21(12-14-24)27-19-20-31-32-27)25-15-17-26(18-16-25)30-33-35-36-34-30/h1-18,20H,19H2,(H,33,34,35,36).
What are the key properties of 5-[4-[2,2-diphenyl-1-[4-(4H-pyrazol-3-yl)phenyl]ethenyl]phenyl]-2H-tetrazole?
5-[4-[2,2-diphenyl-1-[4-(4H-pyrazol-3-yl)phenyl]ethenyl]phenyl]-2H-tetrazole has a molecular weight of 466.55 g/mol, XLogP of 6.05, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-[2,2-diphenyl-1-[4-(4H-pyrazol-3-yl)phenyl]ethenyl]phenyl]-2H-tetrazole is sourced from PubChem (CID 158761008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).