C40H31F6IN4O2 — CID 158777953
4-[2-[2,5-dimethyl-1-[4-(trifluoromethoxy)phenyl]pyrrol-3-yl]ethynyl]pyridine;4-ethynylpyridine;3-iodo-2,5-dimethyl-1-[4-(trifluoromethoxy)phenyl]pyrrole (PubChem CID 158777953) has the molecular formula C40H31F6IN4O2 and a molecular weight of 840.61 g/mol. Its IUPAC name is 4-[2-[2,5-dimethyl-1-[4-(trifluoromethoxy)phenyl]pyrrol-3-yl]ethynyl]pyridine;4-ethynylpyridine;3-iodo-2,5-dimethyl-1-[4-(trifluoromethoxy)phenyl]pyrrole.
| Compound Name | 4-[2-[2,5-dimethyl-1-[4-(trifluoromethoxy)phenyl]pyrrol-3-yl]ethynyl]pyridine;4-ethynylpyridine;3-iodo-2,5-dimethyl-1-[4-(trifluoromethoxy)phenyl]pyrrole |
|---|---|
| PubChem CID | 158777953 |
| Molecular Formula | C40H31F6IN4O2 |
| Molecular Weight | 840.61 g/mol |
| Exact Mass | 840.14 |
| IUPAC Name | 4-[2-[2,5-dimethyl-1-[4-(trifluoromethoxy)phenyl]pyrrol-3-yl]ethynyl]pyridine;4-ethynylpyridine;3-iodo-2,5-dimethyl-1-[4-(trifluoromethoxy)phenyl]pyrrole |
| SMILES | C#Cc1ccncc1.Cc1cc(C#Cc2ccncc2)c(C)n1-c1ccc(OC(F)(F)F)cc1.Cc1cc(I)c(C)n1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H15F3N2O.C13H11F3INO.C7H5N/c1-14-13-17(4-3-16-9-11-24-12-10-16)15(2)25(14)18-5-7-19(8-6-18)26-20(21,22)23;1-8-7-12(17)9(2)18(8)10-3-5-11(6-4-10)19-13(14,15)16;1-2-7-3-5-8-6-4-7/h5-13H,1-2H3;3-7H,1-2H3;1,3-6H |
| InChIKey | IQSBKEMOLMCBGC-UHFFFAOYSA-N |
| XLogP | 10.45 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.61 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|