About butan-2-one;methoxyethane;propane
butan-2-one;methoxyethane;propane (PubChem CID 158787439) has the molecular formula C10H24O2
and a molecular weight of 176.30 g/mol. Its IUPAC name is butan-2-one;methoxyethane;propane.
Molecular Properties
| Compound Name | butan-2-one;methoxyethane;propane |
| PubChem CID | 158787439 |
| Molecular Formula | C10H24O2 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.18 |
| IUPAC Name | butan-2-one;methoxyethane;propane |
| SMILES | CCC.CCC(C)=O.CCOC |
| InChI | InChI=1S/C4H8O.C3H8O.C3H8/c1-3-4(2)5;1-3-4-2;1-3-2/h3H2,1-2H3;3H2,1-2H3;3H2,1-2H3 |
| InChIKey | IRVZCFBUEDTMJG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butan-2-one;methoxyethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;methoxyethane;propane?
The IUPAC name of butan-2-one;methoxyethane;propane (CID 158787439) is butan-2-one;methoxyethane;propane.
What is the SMILES notation for butan-2-one;methoxyethane;propane?
The canonical SMILES for butan-2-one;methoxyethane;propane is CCC.CCC(C)=O.CCOC.
What is the InChIKey of butan-2-one;methoxyethane;propane?
The InChIKey is IRVZCFBUEDTMJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.C3H8O.C3H8/c1-3-4(2)5;1-3-4-2;1-3-2/h3H2,1-2H3;3H2,1-2H3;3H2,1-2H3.
What are the key properties of butan-2-one;methoxyethane;propane?
butan-2-one;methoxyethane;propane has a molecular weight of 176.30 g/mol, XLogP of 3.05, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;methoxyethane;propane is sourced from PubChem (CID 158787439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).