C11H25NO9S — CID 158798823
(2S)-2-[bis(2-hydroxyethyl)amino]propanoic acid;3,4-dihydroxybutane-1-sulfonic acid (PubChem CID 158798823) has the molecular formula C11H25NO9S and a molecular weight of 347.39 g/mol. Its IUPAC name is (2S)-2-[bis(2-hydroxyethyl)amino]propanoic acid;3,4-dihydroxybutane-1-sulfonic acid.
| Compound Name | (2S)-2-[bis(2-hydroxyethyl)amino]propanoic acid;3,4-dihydroxybutane-1-sulfonic acid |
|---|---|
| PubChem CID | 158798823 |
| Molecular Formula | C11H25NO9S |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | (2S)-2-[bis(2-hydroxyethyl)amino]propanoic acid;3,4-dihydroxybutane-1-sulfonic acid |
| SMILES | C[C@@H](C(=O)O)N(CCO)CCO.O=S(=O)(O)CCC(O)CO |
| InChI | InChI=1S/C7H15NO4.C4H10O5S/c1-6(7(11)12)8(2-4-9)3-5-10;5-3-4(6)1-2-10(7,8)9/h6,9-10H,2-5H2,1H3,(H,11,12);4-6H,1-3H2,(H,7,8,9)/t6-;/m0./s1 |
| InChIKey | ITFFRWAXOKFWLS-RGMNGODLSA-N |
| XLogP | -2.64 |
| TPSA | 175.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|