C25H37I2N4O3P3 — CID 158810434
N-[5-[diphosphanyl(phosphanyl)amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-2-(2-oxo-1,3-diazinan-1-yl)propanamide;molecular iodine (PubChem CID 158810434) has the molecular formula C25H37I2N4O3P3 and a molecular weight of 788.33 g/mol. Its IUPAC name is N-[5-[diphosphanyl(phosphanyl)amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-2-(2-oxo-1,3-diazinan-1-yl)propanamide;molecular iodine.
| Compound Name | N-[5-[diphosphanyl(phosphanyl)amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-2-(2-oxo-1,3-diazinan-1-yl)propanamide;molecular iodine |
|---|---|
| PubChem CID | 158810434 |
| Molecular Formula | C25H37I2N4O3P3 |
| Molecular Weight | 788.33 g/mol |
| Exact Mass | 788.02 |
| IUPAC Name | N-[5-[diphosphanyl(phosphanyl)amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-2-(2-oxo-1,3-diazinan-1-yl)propanamide;molecular iodine |
| SMILES | CC(C(=O)NC(Cc1ccccc1)CC(O)C(Cc1ccccc1)N(P)PP)N1CCCNC1=O.II |
| InChI | InChI=1S/C25H37N4O3P3.I2/c1-18(28-14-8-13-26-25(28)32)24(31)27-21(15-19-9-4-2-5-10-19)17-23(30)22(29(33)35-34)16-20-11-6-3-7-12-20;1-2/h2-7,9-12,18,21-23,30,35H,8,13-17,33-34H2,1H3,(H,26,32)(H,27,31); |
| InChIKey | IUPOZUZHGHNEKL-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.33 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|