C38H50N4O5 — CID 149281625
N-[6-cyclohepta-2,4-dien-6-yn-1-yl-5-[[2-(2,6-dimethylcyclohexa-1,3-dien-1-yl)oxyacetyl]amino]-4-hydroxy-1-phenylhexan-2-yl]-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanamide (PubChem CID 149281625) has the molecular formula C38H50N4O5 and a molecular weight of 642.84 g/mol. Its IUPAC name is N-[6-cyclohepta-2,4-dien-6-yn-1-yl-5-[[2-(2,6-dimethylcyclohexa-1,3-dien-1-yl)oxyacetyl]amino]-4-hydroxy-1-phenylhexan-2-yl]-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanamide.
| Compound Name | N-[6-cyclohepta-2,4-dien-6-yn-1-yl-5-[[2-(2,6-dimethylcyclohexa-1,3-dien-1-yl)oxyacetyl]amino]-4-hydroxy-1-phenylhexan-2-yl]-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanamide |
|---|---|
| PubChem CID | 149281625 |
| Molecular Formula | C38H50N4O5 |
| Molecular Weight | 642.84 g/mol |
| Exact Mass | 642.38 |
| IUPAC Name | N-[6-cyclohepta-2,4-dien-6-yn-1-yl-5-[[2-(2,6-dimethylcyclohexa-1,3-dien-1-yl)oxyacetyl]amino]-4-hydroxy-1-phenylhexan-2-yl]-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanamide |
| SMILES | CC1=C(OCC(=O)NC(CC2C#CC=CC=C2)C(O)CC(Cc2ccccc2)NC(=O)C(C(C)C)N2CCCNC2=O)C(C)CC=C1 |
| InChI | InChI=1S/C38H50N4O5/c1-26(2)35(42-21-13-20-39-38(42)46)37(45)40-31(22-29-16-10-7-11-17-29)24-33(43)32(23-30-18-8-5-6-9-19-30)41-34(44)25-47-36-27(3)14-12-15-28(36)4/h5-8,10-12,14,16-18,26,28,30-33,35,43H,13,15,20-25H2,1-4H3,(H,39,46)(H,40,45)(H,41,44) |
| InChIKey | XTBKPYYTLACMPC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.84 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|