C36H45N3O12 — CID 90935258
N-[5-benzyl-8-(2,6-dimethylphenoxy)-1,1,4-trihydroxy-7-oxo-1-(2,3,4,5,6-pentahydroxyphenyl)octan-2-yl]-2-(2-oxo-1,3-diazinan-1-yl)propanamide (PubChem CID 90935258) has the molecular formula C36H45N3O12 and a molecular weight of 711.77 g/mol. Its IUPAC name is N-[5-benzyl-8-(2,6-dimethylphenoxy)-1,1,4-trihydroxy-7-oxo-1-(2,3,4,5,6-pentahydroxyphenyl)octan-2-yl]-2-(2-oxo-1,3-diazinan-1-yl)propanamide.
| Compound Name | N-[5-benzyl-8-(2,6-dimethylphenoxy)-1,1,4-trihydroxy-7-oxo-1-(2,3,4,5,6-pentahydroxyphenyl)octan-2-yl]-2-(2-oxo-1,3-diazinan-1-yl)propanamide |
|---|---|
| PubChem CID | 90935258 |
| Molecular Formula | C36H45N3O12 |
| Molecular Weight | 711.77 g/mol |
| Exact Mass | 711.30 |
| IUPAC Name | N-[5-benzyl-8-(2,6-dimethylphenoxy)-1,1,4-trihydroxy-7-oxo-1-(2,3,4,5,6-pentahydroxyphenyl)octan-2-yl]-2-(2-oxo-1,3-diazinan-1-yl)propanamide |
| SMILES | Cc1cccc(C)c1OCC(=O)CC(Cc1ccccc1)C(O)CC(NC(=O)C(C)N1CCCNC1=O)C(O)(O)c1c(O)c(O)c(O)c(O)c1O |
| InChI | InChI=1S/C36H45N3O12/c1-19-9-7-10-20(2)33(19)51-18-24(40)16-23(15-22-11-5-4-6-12-22)25(41)17-26(38-34(47)21(3)39-14-8-13-37-35(39)48)36(49,50)27-28(42)30(44)32(46)31(45)29(27)43/h4-7,9-12,21,23,25-26,41-46,49-50H,8,13-18H2,1-3H3,(H,37,48)(H,38,47) |
| InChIKey | GJFDZHMZUNQUQU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 249.58 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.77 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|