C35H43N3O11 — CID 91330206
N-[5-benzyl-8-(2,6-dimethylphenoxy)-4-hydroxy-7-oxo-1-phenyloctan-2-yl]-2-(4,4,5,5,6,6-hexahydroxy-2-oxo-1,3-diazinan-1-yl)acetamide (PubChem CID 91330206) has the molecular formula C35H43N3O11 and a molecular weight of 681.74 g/mol. Its IUPAC name is N-[5-benzyl-8-(2,6-dimethylphenoxy)-4-hydroxy-7-oxo-1-phenyloctan-2-yl]-2-(4,4,5,5,6,6-hexahydroxy-2-oxo-1,3-diazinan-1-yl)acetamide.
| Compound Name | N-[5-benzyl-8-(2,6-dimethylphenoxy)-4-hydroxy-7-oxo-1-phenyloctan-2-yl]-2-(4,4,5,5,6,6-hexahydroxy-2-oxo-1,3-diazinan-1-yl)acetamide |
|---|---|
| PubChem CID | 91330206 |
| Molecular Formula | C35H43N3O11 |
| Molecular Weight | 681.74 g/mol |
| Exact Mass | 681.29 |
| IUPAC Name | N-[5-benzyl-8-(2,6-dimethylphenoxy)-4-hydroxy-7-oxo-1-phenyloctan-2-yl]-2-(4,4,5,5,6,6-hexahydroxy-2-oxo-1,3-diazinan-1-yl)acetamide |
| SMILES | Cc1cccc(C)c1OCC(=O)CC(Cc1ccccc1)C(O)CC(Cc1ccccc1)NC(=O)CN1C(=O)NC(O)(O)C(O)(O)C1(O)O |
| InChI | InChI=1S/C35H43N3O11/c1-22-10-9-11-23(2)31(22)49-21-28(39)18-26(16-24-12-5-3-6-13-24)29(40)19-27(17-25-14-7-4-8-15-25)36-30(41)20-38-32(42)37-34(45,46)33(43,44)35(38,47)48/h3-15,26-27,29,40,43-48H,16-21H2,1-2H3,(H,36,41)(H,37,42) |
| InChIKey | BYWOOLUJKWYJJS-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 229.35 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.74 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|