C38H49N3O13 — CID 91577307
N-[5-benzyl-8-(2,6-dimethylphenoxy)-1,1,4-trihydroxy-7-oxo-1-phenyloctan-2-yl]-2-(4,4,5,5,6,6-hexahydroxy-2-oxo-1,3-diazinan-1-yl)-3-methylbutanamide (PubChem CID 91577307) has the molecular formula C38H49N3O13 and a molecular weight of 755.82 g/mol. Its IUPAC name is N-[5-benzyl-8-(2,6-dimethylphenoxy)-1,1,4-trihydroxy-7-oxo-1-phenyloctan-2-yl]-2-(4,4,5,5,6,6-hexahydroxy-2-oxo-1,3-diazinan-1-yl)-3-methylbutanamide.
| Compound Name | N-[5-benzyl-8-(2,6-dimethylphenoxy)-1,1,4-trihydroxy-7-oxo-1-phenyloctan-2-yl]-2-(4,4,5,5,6,6-hexahydroxy-2-oxo-1,3-diazinan-1-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 91577307 |
| Molecular Formula | C38H49N3O13 |
| Molecular Weight | 755.82 g/mol |
| Exact Mass | 755.33 |
| IUPAC Name | N-[5-benzyl-8-(2,6-dimethylphenoxy)-1,1,4-trihydroxy-7-oxo-1-phenyloctan-2-yl]-2-(4,4,5,5,6,6-hexahydroxy-2-oxo-1,3-diazinan-1-yl)-3-methylbutanamide |
| SMILES | Cc1cccc(C)c1OCC(=O)CC(Cc1ccccc1)C(O)CC(NC(=O)C(C(C)C)N1C(=O)NC(O)(O)C(O)(O)C1(O)O)C(O)(O)c1ccccc1 |
| InChI | InChI=1S/C38H49N3O13/c1-22(2)31(41-34(45)40-37(50,51)36(48,49)38(41,52)53)33(44)39-30(35(46,47)27-16-9-6-10-17-27)20-29(43)26(18-25-14-7-5-8-15-25)19-28(42)21-54-32-23(3)12-11-13-24(32)4/h5-17,22,26,29-31,43,46-53H,18-21H2,1-4H3,(H,39,44)(H,40,45) |
| InChIKey | YCPALROHNAAGKD-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 269.81 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.82 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|