C38H51N3O13 — CID 91507486
N-[5-benzyl-4-hydroxy-7-oxo-1-phenyl-8-[3,4,5-trihydroxy-2,6-bis(trihydroxymethyl)phenoxy]octan-2-yl]-2-(1,3-diazinan-1-yl)-3-methylbutanamide (PubChem CID 91507486) has the molecular formula C38H51N3O13 and a molecular weight of 757.83 g/mol. Its IUPAC name is N-[5-benzyl-4-hydroxy-7-oxo-1-phenyl-8-[3,4,5-trihydroxy-2,6-bis(trihydroxymethyl)phenoxy]octan-2-yl]-2-(1,3-diazinan-1-yl)-3-methylbutanamide.
| Compound Name | N-[5-benzyl-4-hydroxy-7-oxo-1-phenyl-8-[3,4,5-trihydroxy-2,6-bis(trihydroxymethyl)phenoxy]octan-2-yl]-2-(1,3-diazinan-1-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 91507486 |
| Molecular Formula | C38H51N3O13 |
| Molecular Weight | 757.83 g/mol |
| Exact Mass | 757.34 |
| IUPAC Name | N-[5-benzyl-4-hydroxy-7-oxo-1-phenyl-8-[3,4,5-trihydroxy-2,6-bis(trihydroxymethyl)phenoxy]octan-2-yl]-2-(1,3-diazinan-1-yl)-3-methylbutanamide |
| SMILES | CC(C)C(C(=O)NC(Cc1ccccc1)CC(O)C(CC(=O)COc1c(C(O)(O)O)c(O)c(O)c(O)c1C(O)(O)O)Cc1ccccc1)N1CCCNC1 |
| InChI | InChI=1S/C38H51N3O13/c1-22(2)31(41-15-9-14-39-21-41)36(47)40-26(17-24-12-7-4-8-13-24)19-28(43)25(16-23-10-5-3-6-11-23)18-27(42)20-54-35-29(37(48,49)50)32(44)34(46)33(45)30(35)38(51,52)53/h3-8,10-13,22,25-26,28,31,39,43-46,48-53H,9,14-21H2,1-2H3,(H,40,47) |
| InChIKey | WGQASBXQFRWOLY-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 272.97 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.83 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|