C38H45N5O5S — CID 154665656
(2S)-N-[(2S,4S,5S)-5-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-2-(2-oxo-1,3-diazinan-1-yl)-3-(1,3-thiazol-5-yl)propanamide (PubChem CID 154665656) has the molecular formula C38H45N5O5S and a molecular weight of 683.88 g/mol. Its IUPAC name is (2S)-N-[(2S,4S,5S)-5-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-2-(2-oxo-1,3-diazinan-1-yl)-3-(1,3-thiazol-5-yl)propanamide.
| Compound Name | (2S)-N-[(2S,4S,5S)-5-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-2-(2-oxo-1,3-diazinan-1-yl)-3-(1,3-thiazol-5-yl)propanamide |
|---|---|
| PubChem CID | 154665656 |
| Molecular Formula | C38H45N5O5S |
| Molecular Weight | 683.88 g/mol |
| Exact Mass | 683.31 |
| IUPAC Name | (2S)-N-[(2S,4S,5S)-5-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-2-(2-oxo-1,3-diazinan-1-yl)-3-(1,3-thiazol-5-yl)propanamide |
| SMILES | Cc1cccc(C)c1OCC(=O)N[C@@H](Cc1ccccc1)[C@@H](O)C[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1cncs1)N1CCCNC1=O |
| InChI | InChI=1S/C38H45N5O5S/c1-26-11-9-12-27(2)36(26)48-24-35(45)42-32(20-29-15-7-4-8-16-29)34(44)21-30(19-28-13-5-3-6-14-28)41-37(46)33(22-31-23-39-25-49-31)43-18-10-17-40-38(43)47/h3-9,11-16,23,25,30,32-34,44H,10,17-22,24H2,1-2H3,(H,40,47)(H,41,46)(H,42,45)/t30-,32-,33-,34-/m0/s1 |
| InChIKey | WWKQGCPWEOQDGE-DYTOPAQESA-N |
| XLogP | 4.37 |
| TPSA | 132.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.88 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |