About 4-chloro-2-hexylphenol;4-chloro-2-pentan-2-ylphenol;4-chlorophenol
4-chloro-2-hexylphenol;4-chloro-2-pentan-2-ylphenol;4-chlorophenol (PubChem CID 158853391) has the molecular formula C29H37Cl3O3
and a molecular weight of 539.97 g/mol. Its IUPAC name is 4-chloro-2-hexylphenol;4-chloro-2-pentan-2-ylphenol;4-chlorophenol.
Molecular Properties
| Compound Name | 4-chloro-2-hexylphenol;4-chloro-2-pentan-2-ylphenol;4-chlorophenol |
| PubChem CID | 158853391 |
| Molecular Formula | C29H37Cl3O3 |
| Molecular Weight | 539.97 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | 4-chloro-2-hexylphenol;4-chloro-2-pentan-2-ylphenol;4-chlorophenol |
| SMILES | CCCC(C)c1cc(Cl)ccc1O.CCCCCCc1cc(Cl)ccc1O.Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H17ClO.C11H15ClO.C6H5ClO/c1-2-3-4-5-6-10-9-11(13)7-8-12(10)14;1-3-4-8(2)10-7-9(12)5-6-11(10)13;7-5-1-3-6(8)4-2-5/h7-9,14H,2-6H2,1H3;5-8,13H,3-4H2,1-2H3;1-4,8H |
| InChIKey | IZSXTOIVEWRHTJ-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 539.97 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-hexylphenol;4-chloro-2-pentan-2-ylphenol;4-chlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-hexylphenol;4-chloro-2-pentan-2-ylphenol;4-chlorophenol?
The IUPAC name of 4-chloro-2-hexylphenol;4-chloro-2-pentan-2-ylphenol;4-chlorophenol (CID 158853391) is 4-chloro-2-hexylphenol;4-chloro-2-pentan-2-ylphenol;4-chlorophenol.
What is the SMILES notation for 4-chloro-2-hexylphenol;4-chloro-2-pentan-2-ylphenol;4-chlorophenol?
The canonical SMILES for 4-chloro-2-hexylphenol;4-chloro-2-pentan-2-ylphenol;4-chlorophenol is CCCC(C)c1cc(Cl)ccc1O.CCCCCCc1cc(Cl)ccc1O.Oc1ccc(Cl)cc1.
What is the InChIKey of 4-chloro-2-hexylphenol;4-chloro-2-pentan-2-ylphenol;4-chlorophenol?
The InChIKey is IZSXTOIVEWRHTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17ClO.C11H15ClO.C6H5ClO/c1-2-3-4-5-6-10-9-11(13)7-8-12(10)14;1-3-4-8(2)10-7-9(12)5-6-11(10)13;7-5-1-3-6(8)4-2-5/h7-9,14H,2-6H2,1H3;5-8,13H,3-4H2,1-2H3;1-4,8H.
What are the key properties of 4-chloro-2-hexylphenol;4-chloro-2-pentan-2-ylphenol;4-chlorophenol?
4-chloro-2-hexylphenol;4-chloro-2-pentan-2-ylphenol;4-chlorophenol has a molecular weight of 539.97 g/mol, XLogP of 10.16, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-hexylphenol;4-chloro-2-pentan-2-ylphenol;4-chlorophenol is sourced from PubChem (CID 158853391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).