C15H28FN — CID 158856151
(4Z)-1,2-ditert-butyl-4-(1-fluoroethylidene)piperidine (PubChem CID 158856151) has the molecular formula C15H28FN and a molecular weight of 241.39 g/mol. Its IUPAC name is (4Z)-1,2-ditert-butyl-4-(1-fluoroethylidene)piperidine.
| Compound Name | (4Z)-1,2-ditert-butyl-4-(1-fluoroethylidene)piperidine |
|---|---|
| PubChem CID | 158856151 |
| Molecular Formula | C15H28FN |
| Molecular Weight | 241.39 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | (4Z)-1,2-ditert-butyl-4-(1-fluoroethylidene)piperidine |
| SMILES | C/C(F)=C1\CCN(C(C)(C)C)C(C(C)(C)C)C1 |
| InChI | InChI=1S/C15H28FN/c1-11(16)12-8-9-17(15(5,6)7)13(10-12)14(2,3)4/h13H,8-10H2,1-7H3/b12-11- |
| InChIKey | PUMQRSDDWMGISJ-QXMHVHEDSA-N |
| XLogP | 4.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |