About dichlorozinc;urea
dichlorozinc;urea (PubChem CID 158861377) has the molecular formula CH4Cl2N2OZn
and a molecular weight of 196.35 g/mol. Its IUPAC name is dichlorozinc;urea.
Molecular Properties
| Compound Name | dichlorozinc;urea |
| PubChem CID | 158861377 |
| Molecular Formula | CH4Cl2N2OZn |
| Molecular Weight | 196.35 g/mol |
| Exact Mass | 193.90 |
| IUPAC Name | dichlorozinc;urea |
| SMILES | Cl[Zn]Cl.NC(N)=O |
| InChI | InChI=1S/CH4N2O.2ClH.Zn/c2-1(3)4;;;/h(H4,2,3,4);2*1H;/q;;;+2/p-2 |
| InChIKey | JARVOPCNRNAXDT-UHFFFAOYSA-L |
| XLogP | 0.40 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.35 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dichlorozinc;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozinc;urea?
The IUPAC name of dichlorozinc;urea (CID 158861377) is dichlorozinc;urea.
What is the SMILES notation for dichlorozinc;urea?
The canonical SMILES for dichlorozinc;urea is Cl[Zn]Cl.NC(N)=O.
What is the InChIKey of dichlorozinc;urea?
The InChIKey is JARVOPCNRNAXDT-UHFFFAOYSA-L. The full InChI is InChI=1S/CH4N2O.2ClH.Zn/c2-1(3)4;;;/h(H4,2,3,4);2*1H;/q;;;+2/p-2.
What are the key properties of dichlorozinc;urea?
dichlorozinc;urea has a molecular weight of 196.35 g/mol, XLogP of 0.40, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozinc;urea is sourced from PubChem (CID 158861377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).