C24H32O3 — CID 158877211
2,6-dimethyloct-7-en-2-yl 3-naphthalen-2-yl-3-oxopropanoate;methane (PubChem CID 158877211) has the molecular formula C24H32O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is 2,6-dimethyloct-7-en-2-yl 3-naphthalen-2-yl-3-oxopropanoate;methane.
| Compound Name | 2,6-dimethyloct-7-en-2-yl 3-naphthalen-2-yl-3-oxopropanoate;methane |
|---|---|
| PubChem CID | 158877211 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 2,6-dimethyloct-7-en-2-yl 3-naphthalen-2-yl-3-oxopropanoate;methane |
| SMILES | C.C=CC(C)CCCC(C)(C)OC(=O)CC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H28O3.CH4/c1-5-17(2)9-8-14-23(3,4)26-22(25)16-21(24)20-13-12-18-10-6-7-11-19(18)15-20;/h5-7,10-13,15,17H,1,8-9,14,16H2,2-4H3;1H4 |
| InChIKey | JCOXKGFEBZXYPQ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|