C19H16F3N3O2 — CID 158882728
N'-(3-cyanopropanoyl)-2-[[4-(trifluoromethyl)phenyl]methyl]benzohydrazide (PubChem CID 158882728) has the molecular formula C19H16F3N3O2 and a molecular weight of 375.35 g/mol. Its IUPAC name is N'-(3-cyanopropanoyl)-2-[[4-(trifluoromethyl)phenyl]methyl]benzohydrazide.
| Compound Name | N'-(3-cyanopropanoyl)-2-[[4-(trifluoromethyl)phenyl]methyl]benzohydrazide |
|---|---|
| PubChem CID | 158882728 |
| Molecular Formula | C19H16F3N3O2 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | N'-(3-cyanopropanoyl)-2-[[4-(trifluoromethyl)phenyl]methyl]benzohydrazide |
| SMILES | N#CCCC(=O)NNC(=O)c1ccccc1Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H16F3N3O2/c20-19(21,22)15-9-7-13(8-10-15)12-14-4-1-2-5-16(14)18(27)25-24-17(26)6-3-11-23/h1-2,4-5,7-10H,3,6,12H2,(H,24,26)(H,25,27) |
| InChIKey | BBRIVYIMQJMYBM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|