C37H75N5O6 — CID 158908289
1-cyclopropyloxy-2,2,6,6-tetramethylpiperidin-4-ol;1-[(dimethylamino)methoxy]-2,2,6,6-tetramethylpiperidin-4-ol;N-(1-ethoxy-2,2,6,6-tetramethylpiperidin-4-yl)acetamide (PubChem CID 158908289) has the molecular formula C37H75N5O6 and a molecular weight of 686.04 g/mol. Its IUPAC name is 1-cyclopropyloxy-2,2,6,6-tetramethylpiperidin-4-ol;1-[(dimethylamino)methoxy]-2,2,6,6-tetramethylpiperidin-4-ol;N-(1-ethoxy-2,2,6,6-tetramethylpiperidin-4-yl)acetamide.
| Compound Name | 1-cyclopropyloxy-2,2,6,6-tetramethylpiperidin-4-ol;1-[(dimethylamino)methoxy]-2,2,6,6-tetramethylpiperidin-4-ol;N-(1-ethoxy-2,2,6,6-tetramethylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 158908289 |
| Molecular Formula | C37H75N5O6 |
| Molecular Weight | 686.04 g/mol |
| Exact Mass | 685.57 |
| IUPAC Name | 1-cyclopropyloxy-2,2,6,6-tetramethylpiperidin-4-ol;1-[(dimethylamino)methoxy]-2,2,6,6-tetramethylpiperidin-4-ol;N-(1-ethoxy-2,2,6,6-tetramethylpiperidin-4-yl)acetamide |
| SMILES | CC1(C)CC(O)CC(C)(C)N1OC1CC1.CCON1C(C)(C)CC(NC(C)=O)CC1(C)C.CN(C)CON1C(C)(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C13H26N2O2.C12H26N2O2.C12H23NO2/c1-7-17-15-12(3,4)8-11(14-10(2)16)9-13(15,5)6;1-11(2)7-10(15)8-12(3,4)14(11)16-9-13(5)6;1-11(2)7-9(14)8-12(3,4)13(11)15-10-5-6-10/h11H,7-9H2,1-6H3,(H,14,16);10,15H,7-9H2,1-6H3;9-10,14H,5-8H2,1-4H3 |
| InChIKey | JGIAMDWEXQZIFJ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.04 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|