C19H4Br2N8O — CID 158923041
5-bromo-4-isocyanobenzimidazol-2-one;(2Z)-2-(5-bromo-4-isocyanobenzimidazol-2-ylidene)-2-isocyanoacetonitrile (PubChem CID 158923041) has the molecular formula C19H4Br2N8O and a molecular weight of 520.10 g/mol. Its IUPAC name is 5-bromo-4-isocyanobenzimidazol-2-one;(2Z)-2-(5-bromo-4-isocyanobenzimidazol-2-ylidene)-2-isocyanoacetonitrile.
| Compound Name | 5-bromo-4-isocyanobenzimidazol-2-one;(2Z)-2-(5-bromo-4-isocyanobenzimidazol-2-ylidene)-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 158923041 |
| Molecular Formula | C19H4Br2N8O |
| Molecular Weight | 520.10 g/mol |
| Exact Mass | 517.89 |
| IUPAC Name | 5-bromo-4-isocyanobenzimidazol-2-one;(2Z)-2-(5-bromo-4-isocyanobenzimidazol-2-ylidene)-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1/N=c2ccc(Br)c([N+]#[C-])c2=N1.[C-]#[N+]c1c(Br)ccc2c1=NC(=O)N=2 |
| InChI | InChI=1S/C11H2BrN5.C8H2BrN3O/c1-14-8(5-13)11-16-7-4-3-6(12)9(15-2)10(7)17-11;1-10-6-4(9)2-3-5-7(6)12-8(13)11-5/h3-4H;2-3H/b11-8-; |
| InChIKey | JIBTZWONRIVEIJ-MKFZHGHUSA-N |
| XLogP | 3.24 |
| TPSA | 103.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.10 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|