C15H27NO7Si — CID 158930911
3-(2-methylprop-2-enoyloxy)propyl 4-[[dimethoxy(methyl)silyl]methylamino]-4-oxobutanoate (PubChem CID 158930911) has the molecular formula C15H27NO7Si and a molecular weight of 361.47 g/mol. Its IUPAC name is 3-(2-methylprop-2-enoyloxy)propyl 4-[[dimethoxy(methyl)silyl]methylamino]-4-oxobutanoate.
| Compound Name | 3-(2-methylprop-2-enoyloxy)propyl 4-[[dimethoxy(methyl)silyl]methylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 158930911 |
| Molecular Formula | C15H27NO7Si |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 3-(2-methylprop-2-enoyloxy)propyl 4-[[dimethoxy(methyl)silyl]methylamino]-4-oxobutanoate |
| SMILES | C=C(C)C(=O)OCCCOC(=O)CCC(=O)NC[Si](C)(OC)OC |
| InChI | InChI=1S/C15H27NO7Si/c1-12(2)15(19)23-10-6-9-22-14(18)8-7-13(17)16-11-24(5,20-3)21-4/h1,6-11H2,2-5H3,(H,16,17) |
| InChIKey | BUHZJRQPMAJJDH-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|